The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[5-Carboxy-3-(carboxy-phosphono-methoxy)-2-hydroxy-phenyl]-2-hydroxy-malonic acid ID: ALA98868
PubChem CID: 44328706
Max Phase: Preclinical
Molecular Formula: C12H11O14P
Molecular Weight: 410.18
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1cc(OC(C(=O)O)P(=O)(O)O)c(O)c(C(O)(C(=O)O)C(=O)O)c1
Standard InChI: InChI=1S/C12H11O14P/c13-6-4(12(22,10(18)19)11(20)21)1-3(7(14)15)2-5(6)26-9(8(16)17)27(23,24)25/h1-2,9,13,22H,(H,14,15)(H,16,17)(H,18,19)(H,20,21)(H2,23,24,25)
Standard InChI Key: WNCBGKJMSWDKGE-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 27 0 0 0 0 0 0 0 0999 V2000
3.9667 -5.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6917 -4.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5417 -4.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5417 -3.7750 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
6.1167 -4.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8292 -5.0167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4000 -5.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6875 -3.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4000 -3.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2667 -4.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4667 -5.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2625 -5.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3917 -2.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1167 -3.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8042 -3.7417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2792 -3.7667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6250 -5.7750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9750 -4.6000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6792 -2.1292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5542 -5.6000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3667 -3.7750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5542 -2.9000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4000 -5.8375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5417 -4.9875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6875 -6.4292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2625 -5.8375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1125 -2.1250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 6 1 0
4 3 1 0
5 7 2 0
6 5 1 0
7 2 1 0
8 2 2 0
9 8 1 0
10 1 1 0
11 1 1 0
12 3 1 0
13 9 1 0
14 9 2 0
15 4 2 0
16 10 2 0
17 11 2 0
18 12 2 0
19 13 2 0
20 1 1 0
21 4 1 0
22 4 1 0
23 7 1 0
24 10 1 0
25 11 1 0
26 12 1 0
27 13 1 0
14 5 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 410.18Molecular Weight (Monoisotopic): 409.9886AlogP: -1.59#Rotatable Bonds: 8Polar Surface Area: 256.42Molecular Species: ACIDHBA: 8HBD: 8#RO5 Violations: 1HBA (Lipinski): 14HBD (Lipinski): 8#RO5 Violations (Lipinski): 2CX Acidic pKa: 1.03CX Basic pKa: ┄CX LogP: -1.71CX LogD: -17.48Aromatic Rings: 1Heavy Atoms: 27QED Weighted: 0.18Np Likeness Score: 0.43
References 1. Peterson ML, Corey SD, Font JL, Walker MC, Sikorski JA. (1996) New simplified inhibitors of EPSP synthase: The importance of ring size for recognition at the shikimate 3-phosphate site, 6 (23): [10.1016/S0960-894X(96)00527-6 ]