Determine the necessary mass, volume, or concentration for preparing a solution.
Basic Description
| Synonyms | Galangin|548-83-4|Norizalpinin|3,5,7-Trihydroxyflavone|3,5,7-Trihydroxy-2-phenyl-4H-chromen-4-one|3,5,7-triOH-Flavone|4H-1-Benzopyran-4-one, 3,5,7-trihydroxy-2-phenyl-|3,5,7-Trihydroxy-2-phenyl-4-benzopyrone|3,5,7-trihydroxy-2-phenylchromen-4-one|FLAVONE, |
|---|---|
| Specifications & Purity | Moligand™, 10mM in DMSO |
| Storage Temp | Store at -80°C |
| Shipped In | Ice chest + Ice pads |
| Grade | Moligand™ |
Names and Identifiers
| IUPAC Name | 3,5,7-trihydroxy-2-phenylchromen-4-one |
|---|---|
| INCHI | InChI=1S/C15H10O5/c16-9-6-10(17)12-11(7-9)20-15(14(19)13(12)18)8-4-2-1-3-5-8/h1-7,16-17,19H |
| InChi Key | VCCRNZQBSJXYJD-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O |
| Isomeric SMILES | C1=CC=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O |
| WGK Germany | 3 |
| RTECS | LK9275500 |
| PubChem CID | 5281616 |
| Molecular Weight | 270.24 |
| Beilstein | 272179 |
Certificates
Certificate of Analysis(COA)
Enter Lot Number to search for COA:
Chemical and Physical Properties
| Melt Point(°C) | 218-225℃ |
|---|
Safety and Hazards(GHS)
| Pictogram(s) | GHS07 |
|---|---|
| Hazard Statements | H315:Causes skin irritation H319:Causes serious eye irritation H335:May cause respiratory irritation |
| Precautionary Statements | P261:Avoid breathing dust/fume/gas/mist/vapors/spray. P305+P351+P338:IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses if present and easy to do - continue rinsing. |
| WGK Germany | 3 |
| RTECS | LK9275500 |
| Merck Index | 4339 |