The store will not work correctly when cookies are disabled.
Gentianine , CAS No.439-89-4
Basic Description
Synonyms | Gentianine | 439-89-4 | Gentiannine | 5-ethenyl-3,4-dihydropyrano[3,4-c]pyridin-1-one | UNII-C2PD310UXB | C2PD310UXB | 5-ethenyl-3,4-dihydro-1H-pyrano[3,4-c]pyridin-1-one | NSC-606848 | BRN 0137011 | CHEBI:28981 | 4-27-00-02817 (Beilstein Handbook Reference) | NSC606848 | 4-(2-h |
Shipped In | Normal |
---|
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 5-ethenyl-3,4-dihydropyrano[3,4-c]pyridin-1-one |
INCHI | InChI=1S/C10H9NO2/c1-2-7-5-11-6-9-8(7)3-4-13-10(9)12/h2,5-6H,1,3-4H2 |
InChi Key | DFNZYFAJQPLJFI-UHFFFAOYSA-N |
Canonical SMILES | C=CC1=CN=CC2=C1CCOC2=O |
Isomeric SMILES | C=CC1=CN=CC2=C1CCOC2=O |
PubChem CID | 354616 |
Molecular Weight | 175.18 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator