The store will not work correctly when cookies are disabled.
Basic Description
Specifications & Purity | ≥95% |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | benzyl (2S)-2-amino-3-methylbutanoate |
INCHI | InChI=1S/C12H17NO2/c1-9(2)11(13)12(14)15-8-10-6-4-3-5-7-10/h3-7,9,11H,8,13H2,1-2H3/t11-/m0/s1 |
InChi Key | YIRBOOICRQFSOK-NSHDSACASA-N |
Canonical SMILES | CC(C)C(C(=O)OCC1=CC=CC=C1)N |
Isomeric SMILES | CC(C)[C@@H](C(=O)OCC1=CC=CC=C1)N |
Alternate CAS | 21760-98-5 |
PubChem CID | 6950584 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator