The store will not work correctly when cookies are disabled.
MCPA sodium salt monohydrate , CAS No.3653-48-3(anhydrous)
Basic Description
Synonyms | MCPA-sodium | MCPA sodium salt | 3653-48-3 | MCPA sodium | Methoxone sodium salt | Sodium MCPA | 2M-4KH sodium salt | Dicotex | MCPA-sodium [ISO] | Sodium (4-chloro-2-methylphenoxy)acetate | 4-Chloro-2-methylphenoxyacetic acid sodium salt | Sodium 2-methyl-4-chlorophenoxyaceta |
Storage Temp | Room temperature |
Shipped In | Normal |
---|
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | sodium;2-(4-chloro-2-methylphenoxy)acetate |
INCHI | InChI=1S/C9H9ClO3.Na/c1-6-4-7(10)2-3-8(6)13-5-9(11)12;/h2-4H,5H2,1H3,(H,11,12);/q;+1/p-1 |
InChi Key | STAPBGVGYWCRTF-UHFFFAOYSA-M |
Canonical SMILES | CC1=C(C=CC(=C1)Cl)OCC(=O)[O-].[Na+] |
Isomeric SMILES | CC1=C(C=CC(=C1)Cl)OCC(=O)[O-].[Na+] |
PubChem CID | 2724048 |
Molecular Weight | 240.62 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator