The store will not work correctly when cookies are disabled.
Metronidazole Acetate , CAS No.13182-82-6
Basic Description
Synonyms | Metronidazole acetate | 13182-82-6 | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl acetate | 2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethyl acetate | O-Acetylmetronidazole | SCHEMBL677158 | CHEMBL1080624 | 2-Methyl-5-nitro-1H-imidazole-1-ethanol acetate (ester) | DTXSID90157219 | MQX |
Shipped In | Normal |
---|
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl acetate |
INCHI | InChI=1S/C8H11N3O4/c1-6-9-5-8(11(13)14)10(6)3-4-15-7(2)12/h5H,3-4H2,1-2H3 |
InChi Key | MQXDTGGRMOLAPU-UHFFFAOYSA-N |
Canonical SMILES | CC1=NC=C(N1CCOC(=O)C)[N+](=O)[O-] |
Isomeric SMILES | CC1=NC=C(N1CCOC(=O)C)[N+](=O)[O-] |
PubChem CID | 83211 |
Molecular Weight | 213.19 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator