The store will not work correctly when cookies are disabled.
Basic Description
Specifications & Purity | ≥99% |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 2-[5-[5-[4-(2-bromo-5-fluorophenoxy)piperidin-1-yl]-1,3,4-thiadiazol-2-yl]tetrazol-2-yl]acetic acid |
INCHI | InChI=1S/C16H15BrFN7O3S/c17-11-2-1-9(18)7-12(11)28-10-3-5-24(6-4-10)16-21-20-15(29-16)14-19-23-25(22-14)8-13(26)27/h1-2,7,10H,3-6,8H2,(H,26,27) |
InChi Key | SVTBUTPWEOUGGT-UHFFFAOYSA-N |
Canonical SMILES | C1CN(CCC1OC2=C(C=CC(=C2)F)Br)C3=NN=C(S3)C4=NN(N=N4)CC(=O)O |
Isomeric SMILES | C1CN(CCC1OC2=C(C=CC(=C2)F)Br)C3=NN=C(S3)C4=NN(N=N4)CC(=O)O |
PubChem CID | 24988880 |
Molecular Weight | 484.31 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator