Determine the necessary mass, volume, or concentration for preparing a solution.
| Activity Type | Activity Value -log(M) | Mechanism of Action | Activity Reference | Publications (PubMed IDs) |
|---|
Basic Description
| Synonyms | 4553-59-7 | PHENYL-PHENYLAMINO-ACETONITRILE | Phenyl(phenylamino)acetonitrile | 2-anilino-2-phenylacetonitrile | 2-phenyl-2-(phenylamino)acetonitrile | Acetonitrile, anilinophenyl- | Benzeneacetonitrile, .alpha.-(phenylamino)- | .alpha.-Anilinophenylacetonitrile | MFCD00 |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Associated Targets(Human)
SGMS2 Tchem Phosphatidylcholine:ceramide cholinephosphotransferase 2 (0 Activities)
SGMS2 Tchem Phosphatidylcholine:ceramide cholinephosphotransferase 2 (194 Activities)
| Activity Type | Relation | Activity value | Units | Action Type | Journal | PubMed Id | doi | Assay Aladdin ID |
|---|
Names and Identifiers
| IUPAC Name | 2-anilino-2-phenylacetonitrile |
|---|---|
| INCHI | InChI=1S/C14H12N2/c15-11-14(12-7-3-1-4-8-12)16-13-9-5-2-6-10-13/h1-10,14,16H |
| InChi Key | XOMUKMGWTCEDRE-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C(C#N)NC2=CC=CC=C2 |
| Isomeric SMILES | C1=CC=C(C=C1)C(C#N)NC2=CC=CC=C2 |
| PubChem CID | 345685 |
| Molecular Weight | 208.265 |
Certificates
Certificate of Analysis(COA)
Enter Lot Number to search for COA: