The store will not work correctly when cookies are disabled.
N-(3-Carbamoyl-phenyl)-succinamic acid , CAS No.74182-38-0
Basic Description
Synonyms | 3-[(3-carbamoylphenyl)carbamoyl]propanoic acid | 4-((3-Carbamoylphenyl)amino)-4-oxobutanoic acid | 4-[(3-carbamoylphenyl)amino]-4-oxobutanoic acid | N-(3-Carbamoyl-phenyl)-succinamic acid | 4-(3-carbamoylanilino)-4-oxobutanoic acid | CBMicro_016742 | Camb |
---|
Associated Targets(Human)
Names and Identifiers
IUPAC Name | 4-(3-carbamoylanilino)-4-oxobutanoic acid |
INCHI | InChI=1S/C11H12N2O4/c12-11(17)7-2-1-3-8(6-7)13-9(14)4-5-10(15)16/h1-3,6H,4-5H2,(H2,12,17)(H,13,14)(H,15,16) |
InChi Key | IQDYBIOBYSQBQY-UHFFFAOYSA-N |
Canonical SMILES | C1=CC(=CC(=C1)NC(=O)CCC(=O)O)C(=O)N |
Isomeric SMILES | C1=CC(=CC(=C1)NC(=O)CCC(=O)O)C(=O)N |
PubChem CID | 722008 |
Molecular Weight | 236.22 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator