The store will not work correctly when cookies are disabled.
N-(4-methylpyridin-2-yl)-4-(pyridin-2-yl)thiazol-2-amine , CAS No.N668419
Basic Description
Synonyms | GNF-Pf-4739 | SMSSF-0625076 | BDBM50263327 | AKOS024284063 | AMS_CNC_ID-1808625351 | PD119481 | 2-(4-methylpyridylamino)-4-(2-pyridyl)thiazole | SR-01000477175 | SR-01000477175-1 | N-(4-methyl-2-pyridyl)-4-(2-pyridyl)thiazol-2-amine | N-(4-methylpyridin-2 |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | N-(4-methylpyridin-2-yl)-4-pyridin-2-yl-1,3-thiazol-2-amine |
INCHI | InChI=1S/C14H12N4S/c1-10-5-7-16-13(8-10)18-14-17-12(9-19-14)11-4-2-3-6-15-11/h2-9H,1H3,(H,16,17,18) |
InChi Key | QMEBVRXZLKAAIG-UHFFFAOYSA-N |
Canonical SMILES | CC1=CC(=NC=C1)NC2=NC(=CS2)C3=CC=CC=N3 |
Isomeric SMILES | CC1=CC(=NC=C1)NC2=NC(=CS2)C3=CC=CC=N3 |
PubChem CID | 704452 |
Molecular Weight | 268.34 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator