The store will not work correctly when cookies are disabled.
N-Acetyl-6-methoxytryptamine , CAS No.22375-73-1
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | N-[2-(6-methoxy-1H-indol-3-yl)ethyl]acetamide |
INCHI | InChI=1S/C13H16N2O2/c1-9(16)14-6-5-10-8-15-13-7-11(17-2)3-4-12(10)13/h3-4,7-8,15H,5-6H2,1-2H3,(H,14,16) |
InChi Key | NJYPALQXNVNJOH-UHFFFAOYSA-N |
Canonical SMILES | CC(=O)NCCC1=CNC2=C1C=CC(=C2)OC |
Isomeric SMILES | CC(=O)NCCC1=CNC2=C1C=CC(=C2)OC |
PubChem CID | 1785786 |
Molecular Weight | 232.28 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator