The store will not work correctly when cookies are disabled.
N-Benzylacetamide - >98.0%(GC), high purity , CAS No.588-46-5
Basic Description
| Synonyms | N-BENZYLACETAMIDE | 588-46-5 | N-Acetylbenzylamine | Benzylacetamide | Acetamide, N-(phenylmethyl)- | Acetamide, N-benzyl- | N-(Phenylmethyl)acetamide | N-benzyl-acetamide | O1QMH7S17P | NSC-8065 | MFCD00059204 | N-Benzyl acetamide | NSC 8065 | EINECS 209-619-2 | BRN 1817692 | AI3-232 |
|---|
| Specifications & Purity | ≥98%(GC) |
|---|
| Shipped In | Normal |
|---|
Associated Targets(non-human)
Names and Identifiers
| Pubchem Sid | 488181361 |
|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488181361 |
|---|
| IUPAC Name | N-benzylacetamide |
|---|
| INCHI | InChI=1S/C9H11NO/c1-8(11)10-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,10,11) |
|---|
| InChi Key | UZJLYRRDVFWSGA-UHFFFAOYSA-N |
|---|
| Canonical SMILES | CC(=O)NCC1=CC=CC=C1 |
|---|
| Isomeric SMILES | CC(=O)NCC1=CC=CC=C1 |
|---|
| RTECS | AB4546300 |
|---|
| PubChem CID | 11500 |
|---|
| Molecular Weight | 149.19 |
|---|
| Beilstein | 12(4)2230 |
|---|
| Reaxy-Rn | 1817692 |
|---|
Chemical and Physical Properties
| Solubility | Soluble in Methanol |
|---|
| Boil Point(°C) | 157°C/2mmHg(lit.) |
|---|
| Melt Point(°C) | 61 °C |
|---|
Safety and Hazards(GHS)
| RTECS | AB4546300 |
|---|
| Reaxy-Rn | 1817692 |
|---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator
H2314275