The store will not work correctly when cookies are disabled.
3-(4-Nitrophenoxy)benzoic acid - 98%, high purity , CAS No.27237-21-4
Basic Description
Synonyms | 3-(4-nitrophenoxy)benzoic acid | 27237-21-4 | MFCD00690134 | 3-(4-Nitro-phenoxy)-benzoic acid | DIHYDROCYCLACET | SMR000171395 | Oprea1_333652 | Oprea1_527786 | MLS000553629 | SCHEMBL177838 | CHEMBL1369092 | RMCHRSGYGNEWJY-UHFFFAOYSA-N | DTXSID801306451 | HMS2537H05 | CBA23721 | 4-(3- |
Specifications & Purity | ≥98% |
Storage Temp | Room temperature |
Shipped In | Normal |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 3-(4-nitrophenoxy)benzoic acid |
INCHI | InChI=1S/C13H9NO5/c15-13(16)9-2-1-3-12(8-9)19-11-6-4-10(5-7-11)14(17)18/h1-8H,(H,15,16) |
InChi Key | RMCHRSGYGNEWJY-UHFFFAOYSA-N |
Canonical SMILES | C1=CC(=CC(=C1)OC2=CC=C(C=C2)[N+](=O)[O-])C(=O)O |
Isomeric SMILES | C1=CC(=CC(=C1)OC2=CC=C(C=C2)[N+](=O)[O-])C(=O)O |
PubChem CID | 767919 |
Molecular Weight | 259.2 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator