The store will not work correctly when cookies are disabled.
R-(-)-N-Demethyl deprenyl , CAS No.56862-28-3
Basic Description
Synonyms | 56862-28-3 | Norselegiline | n-[(2r)-1-phenylpropan-2-yl]prop-2-yn-1-amine | (2R)-1-phenyl-N-prop-2-ynylpropan-2-amine | RNORDEPRENYL | CHEBI:79968 | 5F44WR1I53 | desmethyl selegiline | L-Nordeprenyl | N-((2R)-1-Phenylpropan-2-yl)prop-2-yn-1-amine | L-Desmethyldeprenyl | N-Des |
Shipped In | Normal |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | (2R)-1-phenyl-N-prop-2-ynylpropan-2-amine |
INCHI | InChI=1S/C12H15N/c1-3-9-13-11(2)10-12-7-5-4-6-8-12/h1,4-8,11,13H,9-10H2,2H3/t11-/m1/s1 |
InChi Key | UUFAJPMQSFXDFR-LLVKDONJSA-N |
Canonical SMILES | CC(CC1=CC=CC=C1)NCC#C |
Isomeric SMILES | C[C@H](CC1=CC=CC=C1)NCC#C |
PubChem CID | 185859 |
Molecular Weight | 173.25 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator