The store will not work correctly when cookies are disabled.
Your company account is blocked and you cannot place orders. If you have questions, please contact your company administrator.
(S)-α-methylhistamine , CAS No.S611166, Agonist of H 3 receptor;Agonist of H 4 receptor
Basic Description
Synonyms | AKOS006339244 | NCGC00024659-02 | CHEBI:125525 | (2S)-1-(1H-Imidazol-4-yl)-2-propanamine | BDBM22905 | (S)-alpha-MeHA | Tocris-0572 | (S)-2-(1H-Imidazol-4-yl)-1-methyl-ethylamine | alpha-methylhistamine-dihydrobromide-(S)-(+) | SCHEMBL4008535 | BDBM504725 |
Specifications & Purity | Moligand™ |
Grade | Moligand™ |
Action Type | AGONIST |
Mechanism of action | Agonist of H 3 receptor;Agonist of H 4 receptor |
---|
Associated Targets(Human)
Associated Targets(non-human)
Mechanisms of Action
Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
---|
Histamine H2 receptor antagonist | ANTAGONIST | ALA1941 | Histamine H2 receptor | SINGLE PROTEIN | Homo sapiens | | |
Histamine H2 receptor antagonist | ANTAGONIST | ALA1941 | Histamine H2 receptor | SINGLE PROTEIN | Homo sapiens | | |
Histamine H2 receptor agonist | AGONIST | ALA1941 | Histamine H2 receptor | SINGLE PROTEIN | Homo sapiens | | |
Histamine H2 receptor antagonist | ANTAGONIST | ALA1941 | Histamine H2 receptor | SINGLE PROTEIN | Homo sapiens | | |
Histamine H2 receptor antagonist | ANTAGONIST | ALA1941 | Histamine H2 receptor | SINGLE PROTEIN | Homo sapiens | | |
Histamine H2 receptor antagonist | ANTAGONIST | ALA1941 | Histamine H2 receptor | SINGLE PROTEIN | Homo sapiens | | |
Histamine H2 receptor antagonist | ANTAGONIST | ALA1941 | Histamine H2 receptor | SINGLE PROTEIN | Homo sapiens | | |
Histamine H2 receptor antagonist | ANTAGONIST | ALA1941 | Histamine H2 receptor | SINGLE PROTEIN | Homo sapiens | | |
Histamine H2 receptor agonist | AGONIST | ALA1941 | Histamine H2 receptor | SINGLE PROTEIN | Homo sapiens | | |
Histamine H2 receptor antagonist | ANTAGONIST | ALA1941 | Histamine H2 receptor | SINGLE PROTEIN | Homo sapiens | | |
Names and Identifiers
IUPAC Name | (2S)-1-(3H-imidazol-4-yl)propan-2-amine |
INCHI | InChI=1S/C6H11N3/c1-5(7)2-6-3-8-4-9-6/h3-5H,2,7H2,1H3,(H,8,9)/t5-/m0/s1 |
InChi Key | XNQIOISZPFVUFG-YFKPBYRVSA-N |
Canonical SMILES | C[C@@H](Cc1cnc[nH]1)N |
Isomeric SMILES | C[C@@H](CC1=CN=CN1)N |
PubChem CID | 6603865 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator