The store will not work correctly when cookies are disabled.
Basic Description
Synonyms | 3,3'-Diiodothyronine | 70-40-6 | 2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3-iodophenyl]propanoic acid | GNC4MZ8B3Q | 3,3'-T2 | CHEBI:35430 | T2 | O-(4-hydroxy-3-iodophenyl)-3-iodotyrosine | Tyrosine, O-(4-hydroxy-3-iodophenyl)-3-iodo- | 3, 3'-Diiodo-L-thyronine-(phenoxy-13C6 |
Specifications & Purity | Moligand™ |
Grade | Moligand™ |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3-iodophenyl]propanoic acid |
INCHI | InChI=1S/C15H13I2NO4/c16-10-7-9(2-3-13(10)19)22-14-4-1-8(5-11(14)17)6-12(18)15(20)21/h1-5,7,12,19H,6,18H2,(H,20,21) |
InChi Key | CPCJBZABTUOGNM-UHFFFAOYSA-N |
Canonical SMILES | OC(=O)C(Cc1ccc(c(c1)I)Oc1ccc(c(c1)I)O)N |
Isomeric SMILES | C1=CC(=C(C=C1CC(C(=O)O)N)I)OC2=CC(=C(C=C2)O)I |
PubChem CID | 65559 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator