The store will not work correctly when cookies are disabled.
Ticlopidine N-Oxide , CAS No.79923-55-0
Basic Description
Synonyms | Ticlopidine N-Oxide | 79923-55-0 | 9HC6V97IZ0 | 5-[(2-chlorophenyl)methyl]-5-oxido-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ium | 5-[(2-chlorophenyl)methyl]-4H,5H,6H,7H-thieno[3,2-c]pyridin-5-ium-5-olate | 5-((2-Chlorophenyl)methyl)-5-oxidanidyl-6,7-dihydro-4H-thieno( |
Shipped In | Normal |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 5-[(2-chlorophenyl)methyl]-5-oxido-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ium |
INCHI | InChI=1S/C14H14ClNOS/c15-13-4-2-1-3-11(13)9-16(17)7-5-14-12(10-16)6-8-18-14/h1-4,6,8H,5,7,9-10H2 |
InChi Key | YEICEJCPALKCAT-UHFFFAOYSA-N |
Canonical SMILES | C1C[N+](CC2=C1SC=C2)(CC3=CC=CC=C3Cl)[O-] |
Isomeric SMILES | C1C[N+](CC2=C1SC=C2)(CC3=CC=CC=C3Cl)[O-] |
PubChem CID | 71752573 |
Molecular Weight | 279.79 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator