| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| T379332-5ml | 5ml | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $19.90 |
| Synonyms | 1,10-phenanthroline|66-71-7|o-phenanthroline|Phenanthroline|4,5-diazaphenanthrene|1,10-o-phenanthroline|orthophenanthroline|2-phenanthroline|beta-phenanthroline|phen|1,10-Phenanthroline anhydrous|1,10-Fenanthrolin|.beta.-Phenanthroline|MFCD00011678|[1,10] |
|---|---|
| Specifications & Purity | Moligand™, 2-propanol solution in toluene with 0.2% 1,10-phenanthroline |
| Storage Temp | Room temperature |
| Shipped In | Normal |
| Grade | Moligand™ |
| IUPAC Name | 1,10-phenanthroline |
|---|---|
| INCHI | InChI=1S/C12H8N2/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1/h1-8H |
| InChi Key | DGEZNRSVGBDHLK-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1 |
| Isomeric SMILES | C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1 |
| WGK Germany | 3 |
| RTECS | SF8300000 |
| PubChem CID | 1318 |
| UN Number | 2811 |
| Molecular Weight | 180.21 |
Enter Lot Number to search for COA:
| Flash Point(°C) | >330° |
|---|---|
| Melt Point(°C) | 114-120（℃） |
| Pictogram(s) | GHS06, GHS09 |
|---|---|
| Signal | Danger |
| Hazard Statements | H301:Toxic if swallowed H410:Very toxic to aquatic life with long lasting effects |
| Precautionary Statements | P273:Avoid release to the environment. P301+P310:IF SWALLOWED: Immediately call a POISON CENTER/doctor/... P501:Dispose of contents/container to ... |
| WGK Germany | 3 |
| RTECS | SF8300000 |
| Merck Index | 7214 |
