The store will not work correctly when cookies are disabled.
Z-DL-aspartic acid beta-benzyl ester , CAS No.29880-21-5
Basic Description
Synonyms | Opera_ID_644 | Z-D,L-Asp(OBzl)-OH | SMR000371826 | Z-DL-Aspartic acid beta-benzyl ester | 4-(benzyloxy)-2-(benzyloxycarbonylamino)-4-oxobutanoic acid | O-Benzyl-N-carbobenzyloxy-aspartic acid | SY075100 | Z56753807 | HMS2691M11 | VUKCNAATVIWRTF-UHFFFAOYSA |
Shipped In | Normal |
---|
Associated Targets(Human)
Associated Targets(non-human)
Names and Identifiers
IUPAC Name | 4-oxo-4-phenylmethoxy-2-(phenylmethoxycarbonylamino)butanoic acid |
INCHI | InChI=1S/C19H19NO6/c21-17(25-12-14-7-3-1-4-8-14)11-16(18(22)23)20-19(24)26-13-15-9-5-2-6-10-15/h1-10,16H,11-13H2,(H,20,24)(H,22,23) |
InChi Key | VUKCNAATVIWRTF-UHFFFAOYSA-N |
Canonical SMILES | C1=CC=C(C=C1)COC(=O)CC(C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Isomeric SMILES | C1=CC=C(C=C1)COC(=O)CC(C(=O)O)NC(=O)OCC2=CC=CC=C2 |
PubChem CID | 273366 |
Molecular Weight | 357.36 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator