| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| Z345791-1g | 1g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $74.90 |
| Synonyms | Z-LEU-LEU-OH | A865110 | XGJGWYRHLPSMLW-IRXDYDNUSA-N | (S)-2-((S)-2-(benzyloxycarbonyl)-4-methylpentanamido)-4-methylpentanoic acid | N-Cbz-L-Leu-L-Leu-OH | AS-56436 | N-Benzyloxycarbonyl-L-leucyl-L-leucine | N-Cbz-L-leucinyl-L-leucine | MFCD00038296 | SC |
|---|---|
| Shipped In | Normal |
| Activity Type | Relation | Activity value | Units | Action Type | Journal | PubMed Id | doi | Assay Aladdin ID |
|---|
| IUPAC Name | (2S)-4-methyl-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]pentanoic acid |
|---|---|
| INCHI | InChI=1S/C20H30N2O5/c1-13(2)10-16(18(23)21-17(19(24)25)11-14(3)4)22-20(26)27-12-15-8-6-5-7-9-15/h5-9,13-14,16-17H,10-12H2,1-4H3,(H,21,23)(H,22,26)(H,24,25)/t16-,17-/m0/s1 |
| InChi Key | XGJGWYRHLPSMLW-IRXDYDNUSA-N |
| Canonical SMILES | CC(C)CC(C(=O)NC(CC(C)C)C(=O)O)NC(=O)OCC1=CC=CC=C1 |
| Isomeric SMILES | CC(C)C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)O)NC(=O)OCC1=CC=CC=C1 |
| PubChem CID | 7299379 |
| Molecular Weight | 378.47 |
Enter Lot Number to search for COA:
